For research use only. Not for therapeutic Use.
Isopropyl ferulate(CAT: I017066) is an ester derivative of ferulic acid, a well-known hydroxycinnamic acid with strong antioxidant properties. By esterifying ferulic acid with isopropyl alcohol, this compound gains enhanced lipophilicity, which can improve its stability and penetration in lipid-rich environments such as cell membranes or topical formulations. Isopropyl ferulate has been studied for its potential applications in cosmetics, pharmaceuticals, and food preservation, where it may act as an antioxidant, anti-inflammatory, and UV-protective agent. Its dual role as a functional additive and bioactive molecule makes it a versatile research compound for investigating oxidative stress, skin protection, and formulation science.
| CAS Number | 59831-94-6 |
| Synonyms | propan-2-yl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Molecular Formula | C13H16O4 |
| Purity | ≥95% |
| IUPAC Name | propan-2-yl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChI | InChI=1S/C13H16O4/c1-9(2)17-13(15)7-5-10-4-6-11(14)12(8-10)16-3/h4-9,14H,1-3H3/b7-5+ |
| InChIKey | KBTWMQRNUHIETA-FNORWQNLSA-N |
| SMILES | CC(C)OC(=O)C=CC1=CC(=C(C=C1)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
