For research use only. Not for therapeutic Use.
Allopregnanolone (CAS 516-55-2) is a neuroactive steroid and a derivative of progesterone. Also known as brexanolone, it acts as a positive allosteric modulator of gamma-aminobutyric acid (GABA) receptors, enhancing inhibitory neurotransmission in the central nervous system. Allopregnanolone has gained attention for its potential therapeutic applications, including the treatment of postpartum depression. As a neurosteroid, it plays a crucial role in regulating mood and anxiety.
CAS Number | 516-55-2 |
Synonyms | Sepranolone |
Molecular Formula | C₂₁H₃₄O₂ |
Purity | 98% |
Target | GABA(A) |
Target Protein | P14867,P47869,P34903,P48169,P31644,Q16445,P18505,P47870,P28472,014764,P78334,Q8N1C3,P18507 |
Appearance | Solid |
IUPAC Name | 1-[(3S,5S,8R,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
InChI | InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15-,16-,17+,18-,19-,20-,21+/m0/s1 |
InChIKey | AURFZBICLPNKBZ-FZCSVUEKSA-N |
SMILES | CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |