For research use only. Not for therapeutic Use.
Isookanin（Cat No.:M067298）is a naturally occurring flavonoid belonging to the flavone subclass, structurally identified as a 5,7,4′-trihydroxyflavone. It is found in various medicinal plants, including Bidens pilosa and Achillea millefolium. Known for its antioxidant and anti-inflammatory properties, isookanin helps neutralize free radicals and modulate inflammatory pathways such as NF-κB and MAPK. It also exhibits antibacterial, antidiabetic, and potential anticancer activities, making it a promising compound in pharmaceutical and nutraceutical research. Its multifunctional bioactivity supports applications in skin care, chronic disease prevention, and integrative therapeutic formulations.
| CAS Number | 1036-49-3 |
| Synonyms | (2S)-2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-2,3-dihydrochromen-4-one |
| Molecular Formula | C15H12O6 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C15H12O6/c16-9-3-1-7(5-12(9)19)13-6-11(18)8-2-4-10(17)14(20)15(8)21-13/h1-5,13,16-17,19-20H,6H2/t13-/m0/s1 |
| InChIKey | ZPVNWCMRCGXRJD-ZDUSSCGKSA-N |
| SMILES | C1[C@H](OC2=C(C1=O)C=CC(=C2O)O)C3=CC(=C(C=C3)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
