Glucose isomerase（Cat No.:M018470）, is an enzyme that catalyzes the isomerization of glucose into fructose. This enzymatic process is essential in the production of high-fructose corn syrup (HFCS), a widely used sweetener in the food and beverage industry. Glucose isomerase helps convert glucose, which is less sweet than fructose, into fructose, which is sweeter and more commonly used in sweetening products. HFCS is employed in a wide range of food and beverage products due to its cost-effectiveness and sweetening properties, and glucose isomerase plays a crucial role in its production, making it a valuable enzyme in the food industry.
| Catalog Number | M018470 |
| CAS Number | 9055-00-9 |
| Synonyms | Isomerase, glucose;immobilized glucose isomerast preparation |
| Molecular Formula | C17H17ClN2O3S |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-(2-chlorophenyl)methanone |
| InChI | InChI=1S/C17H17ClN2O3S/c18-16-9-5-4-8-15(16)17(21)19-10-12-20(13-11-19)24(22,23)14-6-2-1-3-7-14/h1-9H,10-13H2 |
| InChIKey | WNQJZQMIEZWFIN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)C2=CC=CC=C2Cl)S(=O)(=O)C3=CC=CC=C3 |
