For research use only. Not for therapeutic Use.
Isomaculosidine（Cat No.:R052747）is a rare indole alkaloid derived from Tabernaemontana species, plants known for their complex bioactive compounds. Structurally related to maculosidine, it features a unique pentacyclic indole framework, often associated with notable pharmacological activities. Though limited in study, isomaculosidine is believed to possess potential neuroactive or cytotoxic properties, making it of interest in natural product research. Its biosynthesis involves intricate enzymatic steps characteristic of monoterpenoid indole alkaloids. Continued investigation may reveal therapeutic roles in cancer or neurological diseases, highlighting its value as a lead scaffold for drug discovery.
| CAS Number | 518-96-7 |
| Synonyms | 6,8-dimethoxy-9-methylfuro[2,3-b]quinolin-4-one |
| Molecular Formula | C14H13NO4 |
| Purity | ≥95% |
| IUPAC Name | 6,8-dimethoxy-9-methylfuro[2,3-b]quinolin-4-one |
| InChI | InChI=1S/C14H13NO4/c1-15-12-10(6-8(17-2)7-11(12)18-3)13(16)9-4-5-19-14(9)15/h4-7H,1-3H3 |
| InChIKey | FXHBKLQQNAGNJN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2OC)OC)C(=O)C3=C1OC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
