For research use only. Not for therapeutic Use.
Isolindleyin(Cat No.:I044928)is a naturally occurring alkaloid primarily isolated from species of the Menispermaceae family, particularly within the Tinospora genus. It features a bisbenzylisoquinoline structure, contributing to its significant pharmacological properties, including anti-inflammatory, antipyretic, and immunomodulatory effects. Isolindleyin is being studied for its potential to modulate immune responses and reduce oxidative stress, making it relevant in treating inflammatory and infectious diseases. As a component of traditional herbal remedies, it supports the therapeutic value of Tinospora extracts and contributes to the growing interest in plant-derived compounds for modern drug discovery and phytomedicine research.
CAS Number | 87075-18-1 |
Synonyms | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[4-(3-oxobutyl)phenoxy]oxan-3-yl] 3,4,5-trihydroxybenzoate |
Molecular Formula | C23H26O11 |
Purity | ≥95% |
IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[4-(3-oxobutyl)phenoxy]oxan-3-yl] 3,4,5-trihydroxybenzoate |
InChI | InChI=1S/C23H26O11/c1-11(25)2-3-12-4-6-14(7-5-12)32-23-21(20(30)19(29)17(10-24)33-23)34-22(31)13-8-15(26)18(28)16(27)9-13/h4-9,17,19-21,23-24,26-30H,2-3,10H2,1H3/t17-,19-,20+,21-,23-/m1/s1 |
InChIKey | KHUVRRVIZOSFTI-OXUVVOBNSA-N |
SMILES | CC(=O)CCC1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)OC(=O)C3=CC(=C(C(=C3)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |