For research use only. Not for therapeutic Use.
Isoeleutherin (Cat No.: I045494) is a naturally occurring naphthoquinone isolated from plants of the Eleutherine genus, traditionally used in herbal medicine. It exhibits diverse biological activities, including antimicrobial, antifungal, antioxidant, and anticancer effects. Isoeleutherin is known to interfere with cellular redox balance, induce apoptosis, and inhibit proliferation in various cancer cell lines. It is also studied for its potential enzyme inhibition properties. Due to its quinone structure, isoeleutherin participates in redox cycling, making it a valuable compound in natural product research, pharmacology, and medicinal chemistry.
| CAS Number | 1078723-14-4 |
| Synonyms | (1S,3S)-9-methoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| Molecular Formula | C16H16O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C16H16O4/c1-8-7-11-13(9(2)20-8)16(18)14-10(15(11)17)5-4-6-12(14)19-3/h4-6,8-9H,7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | IAJIIJBMBCZPSW-IUCAKERBSA-N |
| SMILES | CC1CC2=C(C(O1)C)C(=O)C3=C(C2=O)C=CC=C3OC |
| Reference | [1]. Francesca R Gallo, et al. Polyketides from Eleutherine bulbosa. Nat Prod Res. 2010 Oct;24(16):1578-86. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
