For research use only. Not for therapeutic Use.
Isodeoxycholic acid (7α,12α-Dihydroxycholanoic acid)(CAT: I040646) is a secondary bile acid and the 3β-epimer of ursodeoxycholic acid (UDCA). This bile acid exhibits notable effects on choleresis (bile flow stimulation) and liver biochemistry, making it a useful tool in hepatobiliary research. Isodeoxycholic acid is studied for its role in bile acid metabolism, cholestasis models, and liver function modulation. Its structural similarity to UDCA allows comparative evaluation of epimer-specific activity and potential therapeutic applications. Suitable for investigating bile flow regulation, hepatic detoxification pathways, and gastrointestinal homeostasis, it supports drug development targeting liver and digestive disorders.
| CAS Number | 566-17-6 |
| Synonyms | (4R)-4-[(5S,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Molecular Formula | C24H40O4 |
| Purity | ≥95% |
| IUPAC Name | (4R)-4-[(5S,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| InChI | InChI=1S/C24H40O4/c1-14(7-10-21(27)28)16-8-9-17-22-18(13-20(26)24(16,17)3)23(2)11-5-4-6-15(23)12-19(22)25/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17+,18+,19-,20+,22+,23+,24-/m1/s1 |
| InChIKey | ZHCAAZIHTDCFJX-QLEQUTGBSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCCC4)C)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
