For research use only. Not for therapeutic Use.
Isobavachin(CAT:R035861) is a prenylated flavonoid isolated from Psoralea corylifolia (also known as Babchi), a plant widely used in traditional Chinese and Ayurvedic medicine. It has gained research interest for its diverse pharmacological activities, including antioxidant, anti-inflammatory, neuroprotective, and anticancer effects. Studies show that Isobavachin modulates estrogen receptors, supports bone formation, and promotes osteoblast differentiation, making it a promising candidate for osteoporosis research. Additionally, it exhibits protective effects on neuronal cells, suggesting potential in neurodegenerative disease studies. With its unique prenylated structure and broad bioactivity, Isobavachin represents a valuable natural compound for therapeutic exploration in bone health, cancer, and neurological disorders.
CAS Number | 31524-62-6 |
Synonyms | (2S)-7-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
Molecular Formula | C20H20O4 |
Purity | ≥95% |
IUPAC Name | (2S)-7-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
InChI | InChI=1S/C20H20O4/c1-12(2)3-8-15-17(22)10-9-16-18(23)11-19(24-20(15)16)13-4-6-14(21)7-5-13/h3-7,9-10,19,21-22H,8,11H2,1-2H3/t19-/m0/s1 |
InChIKey | KYFBXCHUXFKMGQ-IBGZPJMESA-N |
SMILES | CC(=CCC1=C(C=CC2=C1OC(CC2=O)C3=CC=C(C=C3)O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |