For research use only. Not for therapeutic Use.
ISAM-140(Cat No.:I011350)is a small molecule inhibitor designed to target specific enzymes or signaling pathways involved in cancer progression and immune regulation. It works by modulating key proteins that influence tumor growth, metastasis, and immune response. In preclinical studies, ISAM-140 has shown potential in inhibiting the growth of various cancer cell types, particularly by disrupting mechanisms that promote tumor survival and immune evasion. Its selective action makes it a promising candidate for targeted cancer therapies. ISAM-140 is also being explored for its ability to enhance the efficacy of immunotherapy treatments.
| CAS Number | 932191-62-3 |
| Synonyms | propan-2-yl 4-(furan-2-yl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| Molecular Formula | C19H19N3O3 |
| Purity | ≥95% |
| IUPAC Name | propan-2-yl 4-(furan-2-yl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| InChI | InChI=1S/C19H19N3O3/c1-11(2)25-18(23)16-12(3)20-19-21-13-7-4-5-8-14(13)22(19)17(16)15-9-6-10-24-15/h4-11,17H,1-3H3,(H,20,21) |
| InChIKey | NYHLRBMDXQBOIB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(N2C3=CC=CC=C3N=C2N1)C4=CC=CO4)C(=O)OC(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |