For research use only. Not for therapeutic Use.
Iron(II) sodium citrate(Cat No.:M098241) is a coordination compound that combines iron(II) ions with sodium citrate, a salt of citric acid. This compound is particularly noted for its bioavailability and is commonly used in supplements and fortification processes to treat or prevent iron deficiency. The iron(II) form is ferrous iron, which is more readily absorbed by the human body compared to the ferric (iron(III)) form. Sodium citrate acts as a chelating agent, stabilizing the iron in a soluble form that is easier for the body to assimilate, enhancing its effectiveness in nutritional applications.
| CAS Number | 144314-88-5 |
| Molecular Formula | C6H5FeNaO7 |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | sodium;2-hydroxypropane-1,2,3-tricarboxylate;iron(2+) |
| InChI | InChI=1S/C6H8O7.Fe.Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;+2;+1/p-3 |
| InChIKey | KXFFQVUPQCREHA-UHFFFAOYSA-K |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Na+].[Fe+2] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |