For research use only. Not for therapeutic Use.
Iristectorigenin B（Cat No.:R072553）is an O-methylated isoflavone primarily isolated from plants of the Iris genus, particularly Iris tectorum. It exhibits a range of pharmacological activities, including anticancer, anti-inflammatory, antioxidant, and antimicrobial effects. Iristectorigenin B has demonstrated the ability to induce apoptosis and inhibit proliferation in various cancer cell lines by modulating key signaling pathways such as PI3K/Akt and MAPK. Its antioxidant properties help neutralize reactive oxygen species, contributing to cellular protection. With its distinct flavonoid structure, Iristectorigenin B holds potential for therapeutic applications in oncology and inflammation-related diseases.
| CAS Number | 86849-77-6 |
| Synonyms | 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one |
| Molecular Formula | C17H14O7 |
| Purity | ≥95% |
| IUPAC Name | 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one |
| InChI | InChI=1S/C17H14O7/c1-22-12-4-3-8(5-10(12)18)9-7-24-13-6-11(19)17(23-2)16(21)14(13)15(9)20/h3-7,18-19,21H,1-2H3 |
| InChIKey | WRZOUWHPDDOJNR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=COC3=C(C2=O)C(=C(C(=C3)O)OC)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
