For research use only. Not for therapeutic Use.
IRF5-IN-1(CAT: I040608) is a selective small-molecule inhibitor that targets the IRF5 (Interferon Regulatory Factor 5) signaling pathway by disrupting IRF5 nuclear translocation without affecting NF-κB p65 activity. Acting through the transporter SLC15A4, it specifically inhibits TLR7/8-induced IRF5 activation, making it a powerful tool for studying innate immune responses and inflammatory signaling. IRF5-IN-1 is particularly useful in autoimmune disease research, including systemic lupus erythematosus (SLE), where dysregulated IRF5 signaling plays a key role. With high potency and selectivity, IRF5-IN-1 enables detailed exploration of IRF5’s role in cytokine production and immune regulation.
| CAS Number | 689270-18-6 |
| Synonyms | 2-(4-ethoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]quinoline-4-carboxamide |
| Molecular Formula | C27H33N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[3-(2-methylpiperidin-1-yl)propyl]quinoline-4-carboxamide |
| InChI | InChI=1S/C27H33N3O2/c1-3-32-22-14-12-21(13-15-22)26-19-24(23-10-4-5-11-25(23)29-26)27(31)28-16-8-18-30-17-7-6-9-20(30)2/h4-5,10-15,19-20H,3,6-9,16-18H2,1-2H3,(H,28,31) |
| InChIKey | CJAGKBRBMHETMY-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)NCCCN4CCCCC4C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
