For research use only. Not for therapeutic Use.
IRES-C11(Cat No.:I044360)is a small-molecule inhibitor that specifically targets internal ribosome entry site (IRES)-mediated translation, a cap-independent mechanism exploited by certain viruses and cancer cells to initiate protein synthesis under stress conditions. By disrupting IRES function, IRES-C11 impairs the translation of oncogenic and viral proteins, making it valuable for studying non-canonical translation pathways. It has demonstrated activity against IRES-dependent gene expression in cancer and viral infections, including hepatitis C virus (HCV). IRES-C11 serves as a potential therapeutic candidate for targeting aberrant translation in disease contexts where cap-independent mechanisms are upregulated.
| CAS Number | 342416-30-2 |
| Synonyms | 3,4-dichloro-1-[(2,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione |
| Molecular Formula | C13H11Cl2NO4 |
| Purity | ≥95% |
| IUPAC Name | 3,4-dichloro-1-[(2,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione |
| InChI | InChI=1S/C13H11Cl2NO4/c1-19-8-4-3-7(9(5-8)20-2)6-16-12(17)10(14)11(15)13(16)18/h3-5H,6H2,1-2H3 |
| InChIKey | SYBFPEVCOHEALP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CN2C(=O)C(=C(C2=O)Cl)Cl)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |