For research use only. Not for therapeutic Use.
Iohexol-d5 is a deuterium-labeled form of iohexol, a non-ionic, low-osmolarity contrast agent used in various imaging techniques such as computed tomography (CT) scans. The deuterium labeling enhances its application in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, allowing for precise tracking and quantification of the compound in pharmacokinetic studies. This labeled iohexol is useful for studying the distribution, metabolism, and excretion of contrast agents, improving the understanding of their behavior in the body. It also aids in optimizing imaging techniques and contrast agent formulations, ensuring accurate and effective diagnostic imaging.
CAS Number | 928623-33-0 |
Synonyms | Omnipaque; Nycodenz; Exypaque. |
Molecular Formula | C19H26I3N3O9 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 5-[acetyl-(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl)amino]-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide |
InChI | InChI=1S/C19H26I3N3O9/c1-8(29)25(4-11(32)7-28)17-15(21)12(18(33)23-2-9(30)5-26)14(20)13(16(17)22)19(34)24-3-10(31)6-27/h9-11,26-28,30-32H,2-7H2,1H3,(H,23,33)(H,24,34)/i4D2,7D2,11D |
InChIKey | NTHXOOBQLCIOLC-OPCJXEHASA-N |
SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])O)O)N(C1=C(C(=C(C(=C1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |