For research use only. Not for therapeutic Use.
INH1 (CAT: I003112) is a small molecule that targets the Hec1/Nek2 mitotic pathway. It has been shown to suppress tumor cell growth in both in vitro culture and in animal studies. INH1 effectively inhibits the proliferation of various human breast cancer cell lines, indicating its potential as an anti-cancer agent. Further research is warranted to explore the underlying mechanisms of action and its potential therapeutic applications in breast cancer treatment.
| CAS Number | 313553-47-8 |
| Synonyms | INH1; |
| Molecular Formula | C18H16N2OS |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20℃ powder |
| IC50 | 10-21 uM (GI50 in human breast cancer cell lines) |
| IUPAC Name | N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]benzamide |
| InChI | InChI=1S/C18H16N2OS/c1-12-8-9-15(13(2)10-12)16-11-22-18(19-16)20-17(21)14-6-4-3-5-7-14/h3-11H,1-2H3,(H,19,20,21) |
| InChIKey | JPMOKRWIYQGMJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CSC(=N2)NC(=O)C3=CC=CC=C3)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |