For research use only. Not for therapeutic Use.
Indolokine A5（Cat No.:I044973）is a synthetic indole-based small molecule designed to modulate immune responses and inflammatory pathways. Structurally characterized by an indole core linked to functionalized aromatic moieties, Indolokine A5 exhibits potent anti-inflammatory and immunomodulatory properties, making it a promising candidate in autoimmune and inflammatory disease research. It may act by regulating cytokine production or interfering with signaling pathways such as NF-κB or JAK/STAT. Indolokine A5 is under investigation for its therapeutic potential in chronic inflammation and cancer immunotherapy.
| CAS Number | 951207-88-8 |
| Synonyms | 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylic acid |
| Molecular Formula | C13H8N2O3S |
| Purity | ≥95% |
| IUPAC Name | 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylic acid |
| InChI | InChI=1S/C13H8N2O3S/c16-11(12-15-10(6-19-12)13(17)18)8-5-14-9-4-2-1-3-7(8)9/h1-6,14H,(H,17,18) |
| InChIKey | FWXYUFQKPJMQEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C3=NC(=CS3)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
