For research use only. Not for therapeutic Use.
Indolizine-2-carboxylic acid methyl ester(CAT: M074213) is a heterocyclic compound featuring an indolizine core, a bicyclic structure consisting of a fused pyrrole and pyridine ring, with a methyl ester group attached to the 2nd position. This compound is commonly used as an intermediate in organic synthesis, especially in the development of pharmaceuticals and other biologically active molecules. The methyl ester functionality makes it suitable for reactions such as hydrolysis, esterification, or amidation, providing flexibility for further chemical modifications. Due to the indolizine scaffold, it is often explored in medicinal chemistry for its potential bioactivity, such as anti-inflammatory, antiviral, or anticancer properties.
CAS Number | 16959-62-9 |
Molecular Formula | C10H9NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl indolizine-2-carboxylate |
InChI | InChI=1S/C10H9NO2/c1-13-10(12)8-6-9-4-2-3-5-11(9)7-8/h2-7H,1H3 |
InChIKey | PZENCFVMMTWFIK-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CN2C=CC=CC2=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |