For research use only. Not for therapeutic Use.
Indole-2-carboxylic acid(Cat No.:R000139)is a heteroaromatic compound featuring a carboxylic acid group at the 2-position of the indole ring. This molecule serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and natural product analogs. Its indole core is a privileged structure in medicinal chemistry, known for its bioactivity and receptor-binding capabilities. The 2-carboxylic acid functionality allows for versatile chemical transformations, including amide coupling and esterification. It is typically supplied as a crystalline solid, sparingly soluble in water, and readily soluble in polar organic solvents.
| CAS Number | 1477-50-5 |
| Synonyms | 2-Carboxyindole; 2-Indolylformic Acid; NSC 16598; |
| Molecular Formula | C9H7NO2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 1H-indole-2-carboxylic acid |
| InChI | InChI=1S/C9H7NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-5,10H,(H,11,12) |
| InChIKey | HCUARRIEZVDMPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |