For research use only. Not for therapeutic Use.
Indane(CAT: R045758) is a bicyclic hydrocarbon consisting of a benzene ring fused to a cyclopentane ring. This simple structure is a key building block in organic chemistry, often utilized as a precursor in the synthesis of pharmaceuticals, agrochemicals, and polymers. Indane derivatives are known for their potential biological activities, making them valuable in medicinal chemistry for the development of drugs targeting various biological receptors. Additionally, indane’s rigid bicyclic framework lends itself to the creation of ligands in coordination chemistry and as a scaffold in the design of complex molecules for materials science.
CAS Number | 496-11-7 |
Synonyms | 2,3-Dihydro-1H-indene; Indan; 1,2-Hydrindene; 2,3-Dihydro-1H-indene; 2,3-Dihydroindene; Benzocyclopentane; Hydrindene; Hydrindonaphthene; NSC 5292 |
Molecular Formula | C9H10 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2,3-dihydro-1H-indene |
InChI | InChI=1S/C9H10/c1-2-5-9-7-3-6-8(9)4-1/h1-2,4-5H,3,6-7H2 |
InChIKey | PQNFLJBBNBOBRQ-UHFFFAOYSA-N |
SMILES | C1CC2=CC=CC=C2C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |