For research use only. Not for therapeutic Use.
Incensole, a 14-membered diterpenoid, is isolated from both essential oils and resins of frankincense. Incensole has shown anti-inflammatory and anti-depression activities due to their ability to activate ion channels in the brain to alleviate anxiety or depression[1].
| CAS Number | 22419-74-5 |
| Synonyms | (1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol |
| Molecular Formula | C20H34O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H34O2/c1-15(2)20-12-11-17(4)8-6-7-16(3)9-10-18(21)19(5,22-20)13-14-20/h7,11,15,18,21H,6,8-10,12-14H2,1-5H3/b16-7+,17-11+/t18-,19+,20+/m0/s1 |
| InChIKey | SSBZLMMXFQMHDP-REDNKFHQSA-N |
| SMILES | CC1=CCCC(=CCC2(CCC(O2)(C(CC1)O)C)C(C)C)C |
| Reference | [1]. Al-Harrasi A, et al. Distribution of the anti-inflammatory and anti-depressant compounds: Incensole and incensole acetate in genus Boswellia. Phytochemistry. 2019 May;161:28-40. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |