For research use only. Not for therapeutic Use.
Inaperisone(CAT: I029296) is a centrally acting muscle relaxant known for its ability to modulate motor control and visceral reflexes. It exerts its pharmacological effects by indirectly influencing GABAB receptors within the brainstem, leading to the inhibition of the micturition reflex and reduction of muscle spasticity. Inaperisone’s mechanism supports its use in models of neurogenic bladder dysfunction, as well as in conditions involving abnormal muscle tone or overactive reflex arcs. Its unique central action profile, distinct from peripheral neuromuscular blockers, makes it a valuable compound for neuropharmacological research targeting spinal and supraspinal pathways involved in muscle relaxation.
| CAS Number | 99323-21-4 |
| Synonyms | 1-(4-ethylphenyl)-2-methyl-3-pyrrolidin-1-ylpropan-1-one |
| Molecular Formula | C16H23NO |
| Purity | ≥95% |
| IUPAC Name | 1-(4-ethylphenyl)-2-methyl-3-pyrrolidin-1-ylpropan-1-one |
| InChI | InChI=1S/C16H23NO/c1-3-14-6-8-15(9-7-14)16(18)13(2)12-17-10-4-5-11-17/h6-9,13H,3-5,10-12H2,1-2H3 |
| InChIKey | VNFAARJCGSAROU-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(=O)C(C)CN2CCCC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
