imidazenil - CAS 151271-08-8

Imidazenil (CAT: M098238) is a chemical compound that belongs to the imidazobenzodiazepine class of drugs. It acts as a positive allosteric modulator of GABA-A receptors, which are neurotransmitter receptors in the brain that regulate inhibitory signaling. Imidazenil exhibits anxiolytic and sedative effects and has been studied for its potential use in treating anxiety disorders and other related conditions. Its mechanism of action involves enhancing the effects of the neurotransmitter GABA, leading to reduced neuronal excitability.

Catalog Number: M098238

CAS Number: 151271-08-8

PubChem Substance ID:355173303

Molecular Formula: C18H12BrFN4O

Molecular Weight:399.223

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

Synonymsimidazenil

Property

Molecular Formula: C18H12BrFN4O
Molecular Weight399.223
Purity≥95%
StorageDesiccate at -20C

Computed Descriptor

IUPAC Name6-(2-bromophenyl)-8-fluoro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide
InChIInChI=1S/C18H12BrFN4O/c19-13-4-2-1-3-11(13)16-12-7-10(20)5-6-14(12)24-9-23-17(18(21)25)15(24)8-22-16/h1-7,9H,8H2,(H2,21,25)
InChIKeyOCJHYHKWUWSHEN-UHFFFAOYSA-N
SMILESC1C2=C(N=CN2C3=C(C=C(C=C3)F)C(=N1)C4=CC=CC=C4Br)C(=O)N