For research use only. Not for therapeutic Use.
Imidafenacin (Cat. No: I002223) is a selective muscarinic receptor antagonist primarily used to treat overactive bladder (OAB). It selectively inhibits M3 and M1 muscarinic receptors, reducing involuntary bladder contractions while minimizing side effects on salivation and cognition. Imidafenacin improves urinary urgency, frequency, and incontinence with a favorable safety profile. Its extended half-life allows for effective symptom control with a lower risk of dry mouth and constipation. It is widely used in urology research and clinical practice for managing bladder dysfunction.
| CAS Number | 170105-16-5 |
| Molecular Formula | C20H21N3O |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO:≥ 7.8 mg/mL |
| Storage | Store at -20°C |
| IC50 | 0.3 nM(M3) [1] |
| IUPAC Name | 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide |
| InChI | 1S/C20H21N3O/c1-16-22-13-15-23(16)14-12-20(19(21)24,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,13,15H,12,14H2,1H3,(H2,21,24) |
| InChIKey | SQKXYSGRELMAAU-UHFFFAOYSA-N |
| SMILES | CC1=NC=CN1CCC(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)N |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |