For research use only. Not for therapeutic Use.
IHVR-11029 (Cat No.: I006906) is a broad-spectrum antiviral small molecule developed to target the endoplasmic reticulum (ER) α-glucosidases I and II, enzymes essential for viral glycoprotein processing and maturation. By inhibiting these host enzymes, IHVR-11029 disrupts proper folding of viral envelope proteins, leading to reduced viral replication. It has demonstrated activity against flaviviruses, filoviruses, and coronaviruses, making it a valuable candidate for antiviral research. IHVR-11029 serves as a key tool for studying host-targeted antiviral strategies, viral pathogenesis, and therapeutic development.
| CAS Number | 1383152-30-4 |
| Synonyms | (2R,3R,4R,5S)-1-[6-(2,5-difluorophenoxy)hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| Molecular Formula | C18H27F2NO5 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H27F2NO5/c19-12-5-6-13(20)16(9-12)26-8-4-2-1-3-7-21-10-15(23)18(25)17(24)14(21)11-22/h5-6,9,14-15,17-18,22-25H,1-4,7-8,10-11H2/t14-,15+,17-,18-/m1/s1 |
| InChIKey | XGCVJVFPIXDHPA-CYGHRXIMSA-N |
| SMILES | C1C(C(C(C(N1CCCCCCOC2=C(C=CC(=C2)F)F)CO)O)O)O |
| Reference | [1]. Jinhong Chang, et al. Small molecule inhibitors of ER α-glucosidases are active against multiple hemorrhagic fever viruses. Antiviral Res. 2013 Jun;98(3):432-40. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
