For research use only. Not for therapeutic Use.
IDO1/TDO-IN-4（Cat No.:I043304）is a small molecule inhibitor targeting the enzymes indoleamine 2,3-dioxygenase 1 (IDO1) and tryptophan 2,3-dioxygenase (TDO), which are involved in the kynurenine pathway. These enzymes play a critical role in immune evasion by regulating tryptophan metabolism, promoting immune suppression in tumor microenvironments. IDO1/TDO-IN-4 has shown potential as an immunotherapy agent by blocking the activity of these enzymes, thus restoring T cell function and enhancing anti-tumor immunity. It is under investigation for its use in cancer treatment, particularly in combination with other immune checkpoint inhibitors.
| CAS Number | 461424-21-5 |
| Synonyms | 1-(1H-imidazol-5-yl)-9H-pyrido[3,4-b]indole |
| Molecular Formula | C14H10N4 |
| Purity | ≥95% |
| IUPAC Name | 1-(1H-imidazol-5-yl)-9H-pyrido[3,4-b]indole |
| InChI | InChI=1S/C14H10N4/c1-2-4-11-9(3-1)10-5-6-16-14(13(10)18-11)12-7-15-8-17-12/h1-8,18H,(H,15,17) |
| InChIKey | HUTBKGSJEGKJBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C4=CN=CN4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
