For research use only. Not for therapeutic Use.
ICI 89406（Cat No.:I010309）is a potent β-adrenergic receptor antagonist developed to investigate cardiovascular regulation and adrenergic signaling. By competitively blocking β-adrenergic receptors, it reduces the effects of catecholamines such as epinephrine and norepinephrine, leading to decreased heart rate, myocardial contractility, and blood pressure. This makes it a valuable research tool for studying cardiac physiology, hypertension, and sympathetic nervous system function. ICI 89406 has also been explored for its potential in arrhythmia and ischemia models. Its selectivity and pharmacological profile support its use in cardiovascular pharmacology and therapeutic development studies.
| CAS Number | 53671-71-9 |
| Synonyms | 1-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-3-phenylurea |
| Molecular Formula | C19H22N4O3 |
| Purity | ≥95% |
| IUPAC Name | 1-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-3-phenylurea |
| InChI | InChI=1S/C19H22N4O3/c20-12-15-6-4-5-9-18(15)26-14-17(24)13-21-10-11-22-19(25)23-16-7-2-1-3-8-16/h1-9,17,21,24H,10-11,13-14H2,(H2,22,23,25) |
| InChIKey | HTLWRKRZKFAAAH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NCCNCC(COC2=CC=CC=C2C#N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
