For research use only. Not for therapeutic Use.
ICI 199441(Cat No.:M019829)is a potent and selective inhibitor of the epidermal growth factor receptor (EGFR) tyrosine kinase. By blocking the activation of EGFR, ICI 199441 interferes with the downstream signaling pathways responsible for cellular proliferation, survival, and migration. This makes it a valuable tool in cancer research, particularly for studying EGFR-dependent tumors. ICI 199441 has shown potential in preclinical studies for enhancing the effectiveness of other cancer treatments, especially in cases of EGFR-mutant or EGFR-overexpressing cancers. Its high specificity and inhibitory potency make it a promising candidate for targeted cancer therapies.
| CAS Number | 115199-84-3 |
| Synonyms | 2-(3,4-dichlorophenyl)-N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;hydrochloride |
| Molecular Formula | C21H25Cl3N2O |
| Purity | ≥95% |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;hydrochloride |
| InChI | InChI=1S/C21H24Cl2N2O.ClH/c1-24(21(26)14-16-9-10-18(22)19(23)13-16)20(15-25-11-5-6-12-25)17-7-3-2-4-8-17;/h2-4,7-10,13,20H,5-6,11-12,14-15H2,1H3;1H/t20-;/m1./s1 |
| InChIKey | VFLWVWZSDBTGQJ-VEIFNGETSA-N |
| SMILES | CN([C@H](CN1CCCC1)C2=CC=CC=C2)C(=O)CC3=CC(=C(C=C3)Cl)Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |