For research use only. Not for therapeutic Use.
Icariside D2（Cat No.:R064782）is a naturally occurring flavonoid glycoside derived from Epimedium species, traditionally known for their medicinal value. As an active metabolite of icariin, it exhibits diverse biological activities including anti-inflammatory, antioxidant, anticancer, and neuroprotective effects. Research highlights its potential to modulate signaling pathways such as PI3K/Akt and MAPK, contributing to apoptosis regulation, angiogenesis inhibition, and protection against oxidative stress. Icariside D2 is increasingly investigated in cancer, cardiovascular, and neurodegenerative disease models, making it a valuable compound for pharmacological and biomedical research.
| CAS Number | 38954-02-8 |
| Synonyms | (2S,3R,4S,5S,6R)-2-[4-(2-hydroxyethyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Formula | C14H20O7 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-(2-hydroxyethyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI | InChI=1S/C14H20O7/c15-6-5-8-1-3-9(4-2-8)20-14-13(19)12(18)11(17)10(7-16)21-14/h1-4,10-19H,5-7H2/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | OJDSCNUKKOKOQJ-RKQHYHRCSA-N |
| SMILES | C1=CC(=CC=C1CCO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
