For research use only. Not for therapeutic Use.
Iberin(CAT: R040641) is a natural compound found in certain plants, particularly in members of the Brassicaceae family, such as watercress (Nasturtium officinale). Its action target involves various biological activities due to its complex chemical structure. The mode of action includes potential anticancer effects through mechanisms like apoptosis induction and inhibition of tumor cell proliferation. Pharmacologically, Iberin has shown promise in preclinical studies as a potential anticancer agent, especially against breast and colon cancer cells.
| CAS Number | 505-44-2 |
| Synonyms | 1-Isothiocyanato-3-(methylsulfinyl)-propane; 3-Methylsulfinylpropyl Isothiocyanate; NSC 321801; |
| Molecular Formula | C5H9NOS2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 1-isothiocyanato-3-methylsulfinylpropane |
| InChI | S/C5H9NOS2/c1-9(7)4-2-3-6-5-8/h2-4H2,1H3 |
| InChIKey | LELAOEBVZLPXAZ-UHFFFAOYSA-N |
| SMILES | CS(=O)CCCN=C=S |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |