For research use only. Not for therapeutic Use.
Hypoxanthine (Cat No.: R004547) is a naturally occurring purine derivative and an intermediate in nucleic acid metabolism. It plays a crucial role in the purine salvage pathway, where it is converted to inosine monophosphate (IMP) by the enzyme hypoxanthine-guanine phosphoribosyltransferase (HGPRT). Hypoxanthine is structurally similar to adenine and guanine and is found in various biological fluids and tissues. It serves as a building block for DNA and RNA synthesis and is widely used in cell culture media and biochemical studies involving nucleotide metabolism.
| CAS Number | 68-94-0 |
| Synonyms | 1,9-Dihydro-6H-purin-6-one; 3H-Purin-6-ol; 6-Hydroxy-1H-purine; 6-Hydroxypurine; 6-Oxopurine; Hypoxanthine enol; NSC 129419; NSC 14665; Purin-6-ol; Sarcine; Sarkin; Sarkine; USP Didanosine Related Compound A; ? |
| Molecular Formula | C5H4N4O |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | 3 years -20C powder |
| IUPAC Name | 3,7-dihydropurin-6-one |
| InChI | InChI=1S/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
| InChIKey | FDGQSTZJBFJUBT-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=O)N=CN2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
