For research use only. Not for therapeutic Use.
| CAS Number | 175281-76-2 |
| Synonyms | Hydroxyethyl photolinker; 4-[4-(1-Hydroxyethyl)-2-methoxy-5-nitrophenoxy]butanoic Acid |
| Molecular Formula | C13H17NO7 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-[4-(1-hydroxyethyl)-2-methoxy-5-nitrophenoxy]butanoic acid |
| InChI | InChI=1S/C13H17NO7/c1-8(15)9-6-11(20-2)12(7-10(9)14(18)19)21-5-3-4-13(16)17/h6-8,15H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | DUIJUTBRRZCWRD-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1[N+](=O)[O-])OCCCC(=O)O)OC)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |