For research use only. Not for therapeutic Use.
Hydroxy-PEG6-acid(CAT: I016310) is a bifunctional polyethylene glycol (PEG) derivative featuring a terminal hydroxyl group on one end and a carboxylic acid group on the other. The PEG6 spacer provides six ethylene glycol units, offering flexibility, hydrophilicity, and enhanced solubility in aqueous and organic systems. The carboxyl group enables coupling to amines or other nucleophiles through amide or ester bond formation, while the hydroxyl group allows further chemical modification or activation. This versatile reagent is widely employed in bioconjugation, polymer modification, drug delivery systems, and surface engineering, where controlled spacing and solubility are critical for effective molecular design.
| CAS Number | 1347750-85-9 |
| Synonyms | 3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C15H30O9 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C15H30O9/c16-2-4-20-6-8-22-10-12-24-14-13-23-11-9-21-7-5-19-3-1-15(17)18/h16H,1-14H2,(H,17,18) |
| InChIKey | LGLHJMFNIHYJBM-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCO)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
