For research use only. Not for therapeutic Use.
Hydroxy-PEG2-C2-PFP ester(CAT: I016987) is a heterobifunctional polyethylene glycol (PEG) linker designed for advanced bioconjugation and materials chemistry. It contains a terminal hydroxyl group for further derivatization and a pentafluorophenyl (PFP) ester for highly efficient amine coupling, enabling the formation of stable amide bonds under mild conditions. The PEG2 spacer and C2 extension impart flexibility, hydrophilicity, and reduced steric hindrance, enhancing solubility and biocompatibility. This dual-reactive design makes Hydroxy-PEG2-C2-PFP ester particularly valuable for protein modification, surface functionalization, PEGylation, and drug delivery research, where precise linker chemistry is required for constructing multifunctional molecules, biomaterials, and therapeutic conjugates.
| CAS Number | 1820673-42-4 |
| Synonyms | (2,3,4,5,6-pentafluorophenyl) 3-[2-(2-hydroxyethoxy)ethoxy]propanoate |
| Molecular Formula | C13H13F5O5 |
| Purity | ≥95% |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-(2-hydroxyethoxy)ethoxy]propanoate |
| InChI | InChI=1S/C13H13F5O5/c14-8-9(15)11(17)13(12(18)10(8)16)23-7(20)1-3-21-5-6-22-4-2-19/h19H,1-6H2 |
| InChIKey | FTFZBMSTIHCECX-UHFFFAOYSA-N |
| SMILES | C(COCCOCCO)C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
