For research use only. Not for therapeutic Use.
Hydroxy Celecoxib is a metabolite of celecoxib, a selective cyclooxygenase-2 (COX-2) inhibitor widely used for pain relief and anti-inflammatory effects. This compound retains some pharmacological activity, contributing to its analgesic properties. Hydroxy Celecoxib is studied for its potential role in reducing inflammation and pain associated with various conditions, including arthritis. Additionally, its unique structure allows for further investigation into its therapeutic applications and safety profile, providing insights into the broader effects of celecoxib and its derivatives in clinical practice.
| CAS Number | 170571-00-3 |
| Synonyms | 4-[5-[4-(Hydroxymethyl)phenyl]-3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenesulfonamide; ? |
| Molecular Formula | C17H14F3N3O3S |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | 4-[5-[4-(hydroxymethyl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| InChI | InChI=1S/C17H14F3N3O3S/c18-17(19,20)16-9-15(12-3-1-11(10-24)2-4-12)23(22-16)13-5-7-14(8-6-13)27(21,25)26/h1-9,24H,10H2,(H2,21,25,26) |
| InChIKey | ICRSYPPLGADZKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |