For research use only. Not for therapeutic Use.
Hydrocinnamic acid(Cat No.:R051239), also known as 3-phenylpropionic acid, is an organic compound with the formula C₉H₁₀O₂. It consists of a phenyl ring attached to a three-carbon propionic acid chain, making it a simple aromatic carboxylic acid. This compound appears as a white crystalline solid and is slightly soluble in water but readily soluble in organic solvents. Hydrocinnamic acid is used as an intermediate in the synthesis of fragrances, pharmaceuticals, and agrochemicals. It exhibits mild antimicrobial properties and serves as a building block in organic synthesis, particularly in the preparation of esters and amides.
| CAS Number | 501-52-0 |
| Synonyms | Benzenepropanoic Acid; 3-Phenyl-n-propionic Acid; 3-Phenylpropanoic Acid; 3-Phenylpropionic Acid; Benzenepropionic Acid; Benzylacetic Acid; Dihydrocinnamic Acid; NSC 9272; β-Phenylpropanoic Acid; β-Phenylpropionic Acid; ω-Phenylpropanoic Acid; |
| Molecular Formula | C9H10O2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | 3-phenylpropanoic acid |
| InChI | InChI=1S/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11) |
| InChIKey | XMIIGOLPHOKFCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |