For research use only. Not for therapeutic Use.
Hydrochlorothiazide(CAT: A000262) is a thiazide diuretic widely used in research related to hypertension, edema, and renal function. With the molecular formula C₇H₈ClN₃O₄S₂, it acts by inhibiting sodium reabsorption in the distal convoluted tubules of the kidney, leading to increased excretion of sodium and water. This mechanism reduces plasma volume and blood pressure, making it a key model compound for studying cardiovascular and renal pharmacology. Hydrochlorothiazide is also employed in metabolic and electrolyte balance investigations, as well as in drug–drug interaction studies. Its well-documented pharmacokinetics and efficacy make it an essential reference in diuretic and antihypertensive research.
| CAS Number | 58-93-5 |
| Synonyms | 58-93-5; Hypothiazide; Esidrix; Oretic; HCTZ |
| Molecular Formula | C7H8ClN3O4S2 |
| Purity | ≥95% |
| Target | TGF-beta/Smad |
| Storage | -20°C |
| IUPAC Name | 6-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChI | 1S/C7H8ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-2,10-11H,3H2,(H2,9,12,13) |
| InChIKey | JZUFKLXOESDKRF-UHFFFAOYSA-N |
| SMILES | C1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |