Home
>
Chemical Reagents>Organic Building Blocks> Hydrazine, [[4-(phenylmethoxy)phenyl]methyl]-, hydrochloride
For research use only. Not for therapeutic Use.
Hydrazine, [[4-(phenylmethoxy)phenyl]methyl]-, hydrochloride(Cat No.:L007666), is a chemical compound featuring a hydrazine core attached to a phenyl group substituted with a methoxy group, and another phenylmethyl group. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a valuable reagent in various chemical transformations, especially in the development of specialized organic molecules. Its versatile nature allows for diverse chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, research purposes, and industrial applications, contributing to advancements in medicinal chemistry research and chemical development.
CAS Number | 237064-54-9 |
Molecular Formula | C14H17ClN2O |
Purity | ≥95% |
IUPAC Name | (4-phenylmethoxyphenyl)methylhydrazine;hydrochloride |
InChI | InChI=1S/C14H16N2O.ClH/c15-16-10-12-6-8-14(9-7-12)17-11-13-4-2-1-3-5-13;/h1-9,16H,10-11,15H2;1H |
InChIKey | RKUUWIOWFPMUTF-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CNN.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |