For research use only. Not for therapeutic Use.
hSMG-1 inhibitor 11e（Cat No.:I044363）is a selective small-molecule inhibitor targeting hSMG-1, a member of the phosphatidylinositol 3-kinase-related kinase (PIKK) family involved in nonsense-mediated mRNA decay (NMD) and cellular stress responses. By inhibiting hSMG-1 activity, compound 11e interferes with NMD, leading to the stabilization of mRNAs containing premature stop codons and altering gene expression profiles. This mechanism has therapeutic potential in genetic disorders caused by nonsense mutations and in cancer, where NMD modulation may enhance tumor antigen presentation. hSMG-1 inhibitor 11e is a valuable research tool for studying RNA surveillance and gene regulation.
| CAS Number | 1402452-10-1 |
| Synonyms | 1-[4-[4-[2-[3-(dimethylsulfamoyl)-4-methylanilino]pyrimidin-4-yl]pyridin-2-yl]phenyl]-3-methylurea |
| Molecular Formula | C26H27N7O3S |
| Purity | ≥95% |
| IUPAC Name | 1-[4-[4-[2-[3-(dimethylsulfamoyl)-4-methylanilino]pyrimidin-4-yl]pyridin-2-yl]phenyl]-3-methylurea |
| InChI | InChI=1S/C26H27N7O3S/c1-17-5-8-21(16-24(17)37(35,36)33(3)4)30-25-29-14-12-22(32-25)19-11-13-28-23(15-19)18-6-9-20(10-7-18)31-26(34)27-2/h5-16H,1-4H3,(H2,27,31,34)(H,29,30,32) |
| InChIKey | FOFHDVOENOAIGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)C3=CC(=NC=C3)C4=CC=C(C=C4)NC(=O)NC)S(=O)(=O)N(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
