For research use only. Not for therapeutic Use.
HS-1793（Cat No.:I012571）is a potent, selective inhibitor designed to target specific enzymes involved in cellular signaling pathways, particularly those related to cancer cell growth and survival. It functions by inhibiting key proteins that regulate tumorigenesis, offering potential therapeutic benefits in cancer treatment. HS-1793 has demonstrated efficacy in preclinical studies, showing the ability to suppress tumor growth and improve treatment outcomes when used in combination with other therapies. Its high specificity and potency make it an important tool in cancer research and a promising candidate for targeted cancer therapies.
| CAS Number | 927885-00-5 |
| Synonyms | 4-(6-hydroxynaphthalen-2-yl)benzene-1,3-diol |
| Molecular Formula | C16H12O3 |
| Purity | ≥95% |
| IUPAC Name | 4-(6-hydroxynaphthalen-2-yl)benzene-1,3-diol |
| InChI | InChI=1S/C16H12O3/c17-13-4-3-10-7-12(2-1-11(10)8-13)15-6-5-14(18)9-16(15)19/h1-9,17-19H |
| InChIKey | BXZJBSHLEZAMOP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C=C1C3=C(C=C(C=C3)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
