For research use only. Not for therapeutic Use.
Homophthalimide(Cat No.:M136673) is a chemical compound with potential biological and synthetic applications. It contains a phthalimide moiety, which is a cyclic imide. Homophthalimide has been investigated for its anticonvulsant properties and has shown promise in animal models. Additionally, it is used as a building block in organic synthesis, particularly in the preparation of heterocyclic compounds. Its structure allows for the introduction of various functional groups, making it valuable in the development of new materials and pharmaceuticals.
CAS Number | 4456-77-3 |
Molecular Formula | C9H7NO2 |
Purity | 95% |
Analysis method | HPLC |
IUPAC Name | 4H-isoquinoline-1,3-dione |
InChI | InChI=1S/C9H7NO2/c11-8-5-6-3-1-2-4-7(6)9(12)10-8/h1-4H,5H2,(H,10,11,12) |
InChIKey | QGNQEODJYRGEJX-UHFFFAOYSA-N |
SMILES | C1C2=CC=CC=C2C(=O)NC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |