For research use only. Not for therapeutic Use.
HO-PEG18-OH(Cat No.:I045196)is a linear polyethylene glycol (PEG) derivative with 18 ethylene glycol repeating units, terminated by hydroxyl groups at both ends. Its hydrophilic, biocompatible, and flexible polymer chain enhances solubility, stability, and circulation time of conjugated molecules. HO-PEG18-OH is widely used in bioconjugation, drug delivery systems, and surface modification to improve pharmacokinetics and reduce immunogenicity. The terminal hydroxyl groups enable further functionalization for attaching drugs, targeting ligands, or other bioactive agents. This reagent is valuable in biomedical research, nanotechnology, and material science for developing advanced therapeutic and diagnostic platforms.
| CAS Number | 4445-03-8 |
| Synonyms | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| Molecular Formula | C36H74O19 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChI | InChI=1S/C36H74O19/c37-1-3-39-5-7-41-9-11-43-13-15-45-17-19-47-21-23-49-25-27-51-29-31-53-33-35-55-36-34-54-32-30-52-28-26-50-24-22-48-20-18-46-16-14-44-12-10-42-8-6-40-4-2-38/h37-38H,1-36H2 |
| InChIKey | WPTOGBNHVWOHQK-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |