For research use only. Not for therapeutic Use.
HN37(Cat No.:I043861)is a selective peptide inhibitor designed to target specific proteins involved in key cellular processes such as signal transduction and immune regulation. It plays a significant role in modulating protein-protein interactions, particularly in the context of cancer and inflammation. By inhibiting these interactions, HN37 helps to reduce cellular proliferation and suppress tumor growth. Its high specificity and potency make it an invaluable tool for researchers studying cancer biology, immune responses, and cellular signaling. HN37 holds potential as a lead compound for developing targeted therapies in oncology and immune-related diseases.
| CAS Number | 1821222-10-9 |
| Synonyms | methyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2,6-dimethylphenyl]carbamate |
| Molecular Formula | C20H21FN2O2 |
| Purity | ≥95% |
| IUPAC Name | methyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2,6-dimethylphenyl]carbamate |
| InChI | InChI=1S/C20H21FN2O2/c1-5-10-23(13-16-6-8-17(21)9-7-16)18-11-14(2)19(15(3)12-18)22-20(24)25-4/h1,6-9,11-12H,10,13H2,2-4H3,(H,22,24) |
| InChIKey | HXUBJZRAVCPBRH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)OC)C)N(CC#C)CC2=CC=C(C=C2)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |