For research use only. Not for therapeutic Use.
Hispidulin (Cat No.: M048517) is a naturally occurring flavonoid compound classified as a flavone, specifically 4′,5,7-trihydroxy-6-methoxyflavone. Found in various medicinal plants such as Salvia and Artemisia species, hispidulin exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, anticonvulsant, and anticancer activities. It modulates GABA receptors, contributing to its neuroprotective effects, and is under investigation for potential use in epilepsy, anxiety, and tumor suppression. Its natural origin and broad bioactivity make it a promising lead compound in phytopharmaceutical and biomedical research.
| CAS Number | 1447-88-7 |
| Synonyms | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one |
| Molecular Formula | C16H12O6 |
| Purity | ≥95% |
| Target | Pim |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Desiccate at -20℃ |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one |
| InChI | InChI=1S/C16H12O6/c1-21-16-11(19)7-13-14(15(16)20)10(18)6-12(22-13)8-2-4-9(17)5-3-8/h2-7,17,19-20H,1H3 |
| InChIKey | IHFBPDAQLQOCBX-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1O)OC(=CC2=O)C3=CC=C(C=C3)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |