For research use only. Not for therapeutic Use.
Hirsutenone（Cat No.:R063398）is a naturally occurring diarylheptanoid isolated from Alnus species, recognized for its diverse pharmacological activities. It exhibits strong anti-inflammatory effects by inhibiting NF-κB and MAPK signaling pathways, leading to the suppression of pro-inflammatory cytokines. Additionally, hirsutenone demonstrates antioxidant, antimicrobial, and anticancer properties, making it a valuable compound in disease-related research. Its ability to modulate multiple cellular pathways highlights potential therapeutic applications in inflammatory disorders, cancer, and metabolic diseases. This multifunctional natural product is widely explored in pharmacology and medicinal chemistry studies.
| CAS Number | 41137-87-5 |
| Synonyms | (E)-1,7-bis(3,4-dihydroxyphenyl)hept-4-en-3-one |
| Molecular Formula | C19H20O5 |
| Purity | ≥95% |
| IUPAC Name | (E)-1,7-bis(3,4-dihydroxyphenyl)hept-4-en-3-one |
| InChI | InChI=1S/C19H20O5/c20-15(8-5-14-7-10-17(22)19(24)12-14)4-2-1-3-13-6-9-16(21)18(23)11-13/h2,4,6-7,9-12,21-24H,1,3,5,8H2/b4-2+ |
| InChIKey | VWHYFMQKJYFLCC-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1CC/C=C/C(=O)CCC2=CC(=C(C=C2)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
