For research use only. Not for therapeutic Use.
Hexylresorcinol(Cat No.:I001417)is a phenolic compound with antiseptic, antimicrobial, and anesthetic properties. It is commonly used in oral care products, such as lozenges and mouthwashes, to soothe sore throats and prevent infections. Hexylresorcinol works by disrupting microbial cell membranes and inhibiting their enzymatic activity, making it effective against bacteria and fungi. Additionally, it has skin-lightening properties and is included in cosmetic formulations for its ability to inhibit melanin production. Its broad-spectrum efficacy and safety profile make hexylresorcinol a versatile ingredient in healthcare and cosmetic products.
| CAS Number | 136-77-6 |
| Synonyms | 4-hexylbenzene-1,3-diol |
| Molecular Formula | C12H18O2 |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | DMSO: ≥ 1.8 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 4-hexylbenzene-1,3-diol |
| InChI | InChI=1S/C12H18O2/c1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h7-9,13-14H,2-6H2,1H3 |
| InChIKey | WFJIVOKAWHGMBH-UHFFFAOYSA-N |
| SMILES | CCCCCCC1=C(C=C(C=C1)O)O |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |