Hexoprenaline is a bronchodilator used in pharmaceutical research for its efficacy in treating respiratory conditions such as asthma and chronic obstructive pulmonary disease (COPD). It works by relaxing bronchial muscles and improving airflow. This compound is essential for studying the pharmacodynamics and therapeutic applications of bronchodilators, ensuring precise and reliable results in advanced respiratory research and drug development.
Catalog Number | R015359 |
CAS Number | 3215-70-1 |
Synonyms | 4,4’-[1,6-Hexanediylbis[imino(1-hydroxy-2,1-ethanediyl)]]bis-1,2-benzenediol; α,α’-[hexamethylenebis(iminomethylene)]bis[3,4-dihydroxybenzyl Alcohol; Broncholysin; Byk 1512; Hexoprenaline; Ipradol; N,N’-Bis[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]hexa |
Molecular Formula | C22H32N2O6 |
Purity | 95% |
Storage | Desiccate at RT |
IUPAC Name | 4-[2-[6-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]benzene-1,2-diol |
InChI | InChI=1S/C22H32N2O6/c25-17-7-5-15(11-19(17)27)21(29)13-23-9-3-1-2-4-10-24-14-22(30)16-6-8-18(26)20(28)12-16/h5-8,11-12,21-30H,1-4,9-10,13-14H2 |
InChIKey | OXLZNBCNGJWPRV-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(CNCCCCCCNCC(C2=CC(=C(C=C2)O)O)O)O)O)O |