For research use only. Not for therapeutic Use.
Hexamethylene bisacetamide (Cat No.:I011921) is a chemical compound used in biomedical research for its potential to induce differentiation in cancer cells, particularly in leukemia and other malignancies. It works by activating gene expression pathways that promote cell differentiation, thereby reducing the uncontrolled proliferation typical of cancer cells. HMBA has shown promise in preclinical studies as a potential therapeutic agent for treating hematologic cancers and solid tumors. Additionally, it is being explored for its role in regulating cellular processes such as apoptosis and gene expression. However, its clinical applications are still under investigation.
CAS Number | 3073-59-4 |
Synonyms | Diacetyldiaminohexane; Hexamethylene bisacetamide; HMBA;;N,N/’-(hexane-1,6-diyl)diacetamide |
Molecular Formula | C10H20N2O2 |
Purity | ≥95% |
Target | transcription elongation factor b inhibitor |
Solubility | Soluble in DMSO |
Storage | Store at 0-8 °C |
IUPAC Name | N-(6-acetamidohexyl)acetamide |
InChI | InChI=1S/C10H20N2O2/c1-9(13)11-7-5-3-4-6-8-12-10(2)14/h3-8H2,1-2H3,(H,11,13)(H,12,14) |
InChIKey | BNQSTAOJRULKNX-UHFFFAOYSA-N |
SMILES | CC(=O)NCCCCCCNC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |