For research use only. Not for therapeutic Use.
Hexachlorodisiloxane (Cat No.: M052486) is an organosilicon compound composed of two silicon atoms linked by an oxygen bridge, with each silicon atom bonded to three chlorine atoms. It is a volatile, reactive liquid primarily used as a precursor in the synthesis of silicone polymers and other organosilicon compounds. Due to its high reactivity with water, it undergoes hydrolysis to form silanols and hydrochloric acid. Hexachlorodisiloxane is valuable in surface modification, chemical vapor deposition (CVD), and as a cross-linking agent in advanced materials.
| CAS Number | 14986-21-1 |
| Molecular Formula | Cl6OSi2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | trichloro(trichlorosilyloxy)silane |
| InChI | InChI=1S/Cl6OSi2/c1-8(2,3)7-9(4,5)6 |
| InChIKey | QHAHOIWVGZZELU-UHFFFAOYSA-N |
| SMILES | O([Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
