For research use only. Not for therapeutic Use.
Heptakis-(6-mercapto-6-deoxy)-beta-cyclodextrin(Cat No.:L015919)is a chemically modified form of beta-cyclodextrin, where each of the seven primary hydroxyl groups has been replaced with a mercapto group. This modification greatly enhances its binding affinity and selectivity towards heavy metals and certain organic compounds, making it exceptionally useful in environmental remediation, particularly for removing pollutants from water. The inclusion of mercapto groups also allows this cyclodextrin derivative to form stable complexes with various ions and molecules, which can be leveraged in drug delivery systems to improve the solubility and stability of pharmaceuticals.
CAS Number | 160661-60-9 |
Molecular Formula | C42H70O28S7 |
Purity | ≥95% |
IUPAC Name | 5,10,15,20,25,30,35-heptakis(sulfanylmethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-tetradecaoxaoctacyclo[31.2.2.23,6.28,11.213,16.218,21.223,26.228,31]nonatetracontane-36,37,38,39,40,41,42,43,44,45,46,47,48,49-tetradecol |
InChI | InChI=1S/C42H70O28S7/c43-15-22(50)36-57-8(1-71)29(15)64-37-23(51)16(44)31(10(3-73)58-37)66-39-25(53)18(46)33(12(5-75)60-39)68-41-27(55)20(48)35(14(7-77)62-41)70-42-28(56)21(49)34(13(6-76)63-42)69-40-26(54)19(47)32(11(4-74)61-40)67-38-24(52)17(45)30(65-36)9(2-72)59-38/h8-56,71-77H,1-7H2 |
InChIKey | MAQZFSOYQPJIOQ-UHFFFAOYSA-N |
SMILES | C(C1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(O2)C(C8O)O)CS)CS)CS)CS)CS)CS)O)O)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |